C18H23N3O6S2 — CID 30261797
2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyphenyl)acetamide (PubChem CID 30261797) has the molecular formula C18H23N3O6S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30261797 |
| Molecular Formula | C18H23N3O6S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN(c1ccc(S(=O)(=O)N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H23N3O6S2/c1-20(2)29(25,26)15-11-9-14(10-12-15)21(28(4,23)24)13-18(22)19-16-7-5-6-8-17(16)27-3/h5-12H,13H2,1-4H3,(H,19,22) |
| InChIKey | MYLJUILAXKPXIN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |