C21H28N4O6S2 — CID 30271239
2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-propylbenzamide (PubChem CID 30271239) has the molecular formula C21H28N4O6S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-propylbenzamide.
| Compound Name | 2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 30271239 |
| Molecular Formula | C21H28N4O6S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1NC(=O)CN(c1ccc(S(=O)(=O)N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H28N4O6S2/c1-5-14-22-21(27)18-8-6-7-9-19(18)23-20(26)15-25(32(4,28)29)16-10-12-17(13-11-16)33(30,31)24(2)3/h6-13H,5,14-15H2,1-4H3,(H,22,27)(H,23,26) |
| InChIKey | QBVCURDVMHKXFN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |