C21H28N4O7S2 — CID 30271390
2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 30271390) has the molecular formula C21H28N4O7S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 30271390 |
| Molecular Formula | C21H28N4O7S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)CN(c1ccc(S(=O)(=O)N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H28N4O7S2/c1-24(2)34(30,31)17-11-9-16(10-12-17)25(33(4,28)29)15-20(26)23-19-8-6-5-7-18(19)21(27)22-13-14-32-3/h5-12H,13-15H2,1-4H3,(H,22,27)(H,23,26) |
| InChIKey | YZCPGJZJAYEUJP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|