C14H23N3O6S2 — CID 30257475
2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyethyl)acetamide (PubChem CID 30257475) has the molecular formula C14H23N3O6S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 30257475 |
| Molecular Formula | C14H23N3O6S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(c1ccc(S(=O)(=O)N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C14H23N3O6S2/c1-16(2)25(21,22)13-7-5-12(6-8-13)17(24(4,19)20)11-14(18)15-9-10-23-3/h5-8H,9-11H2,1-4H3,(H,15,18) |
| InChIKey | FSAXBKNINQYNLT-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|