C14H22N2O4S — CID 2272160
N-(3-methoxypropyl)-2-(4-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 2272160) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(4-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-methoxypropyl)-2-(4-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2272160 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(3-methoxypropyl)-2-(4-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | COCCCNC(=O)CN(c1ccc(C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O4S/c1-12-5-7-13(8-6-12)16(21(3,18)19)11-14(17)15-9-4-10-20-2/h5-8H,4,9-11H2,1-3H3,(H,15,17) |
| InChIKey | KJPADDYAYDOYTJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|