C13H18F2N2O4S — CID 9172892
2-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide (PubChem CID 9172892) has the molecular formula C13H18F2N2O4S and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 9172892 |
| Molecular Formula | C13H18F2N2O4S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C13H18F2N2O4S/c1-21-7-3-6-16-13(18)9-17(22(2,19)20)10-4-5-11(14)12(15)8-10/h4-5,8H,3,6-7,9H2,1-2H3,(H,16,18) |
| InChIKey | RBZWKWNUOYYWJM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|