C16H22F2N2O3S2 — CID 100592360
N-(2-cyclopentylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide (PubChem CID 100592360) has the molecular formula C16H22F2N2O3S2 and a molecular weight of 392.49 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 100592360 |
| Molecular Formula | C16H22F2N2O3S2 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCSC1CCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H22F2N2O3S2/c1-25(22,23)20(12-6-7-14(17)15(18)10-12)11-16(21)19-8-9-24-13-4-2-3-5-13/h6-7,10,13H,2-5,8-9,11H2,1H3,(H,19,21) |
| InChIKey | FTBKCSTWNFMFAV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|