C18H26F2N2O3S2 — CID 133170726
N-(2-cyclohexylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide (PubChem CID 133170726) has the molecular formula C18H26F2N2O3S2 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 133170726 |
| Molecular Formula | C18H26F2N2O3S2 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CC(C(=O)NCCSC1CCCCC1)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H26F2N2O3S2/c1-13(18(23)21-10-11-26-15-6-4-3-5-7-15)22(27(2,24)25)14-8-9-16(19)17(20)12-14/h8-9,12-13,15H,3-7,10-11H2,1-2H3,(H,21,23) |
| InChIKey | SFJSZILEBLXOES-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|