C15H23F2N3O3S — CID 133228169
2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(dimethylamino)propyl]propanamide (PubChem CID 133228169) has the molecular formula C15H23F2N3O3S and a molecular weight of 363.43 g/mol. Its IUPAC name is 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(dimethylamino)propyl]propanamide.
| Compound Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(dimethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 133228169 |
| Molecular Formula | C15H23F2N3O3S |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(dimethylamino)propyl]propanamide |
| SMILES | CC(C(=O)NCCCN(C)C)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C15H23F2N3O3S/c1-11(15(21)18-8-5-9-19(2)3)20(24(4,22)23)12-6-7-13(16)14(17)10-12/h6-7,10-11H,5,8-9H2,1-4H3,(H,18,21) |
| InChIKey | VQANQCWQPVWSRT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|