C17H24Cl2N2O3S2 — CID 100583996
(2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dichloro-N-methylsulfonylanilino)propanamide (PubChem CID 100583996) has the molecular formula C17H24Cl2N2O3S2 and a molecular weight of 439.43 g/mol. Its IUPAC name is (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dichloro-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dichloro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 100583996 |
| Molecular Formula | C17H24Cl2N2O3S2 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dichloro-N-methylsulfonylanilino)propanamide |
| SMILES | C[C@H](C(=O)NCCSC1CCCC1)N(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H24Cl2N2O3S2/c1-12(17(22)20-9-10-25-14-5-3-4-6-14)21(26(2,23)24)13-7-8-15(18)16(19)11-13/h7-8,11-12,14H,3-6,9-10H2,1-2H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | QKOXZHYJHMBZNK-GFCCVEGCSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|