C20H32N2O4S2 — CID 133239121
N-(2-cyclohexylsulfanylethyl)-2-(4-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 133239121) has the molecular formula C20H32N2O4S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-2-(4-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-2-(4-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133239121 |
| Molecular Formula | C20H32N2O4S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-2-(4-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CCC(C(=O)NCCSC1CCCCC1)N(c1ccc(OC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H32N2O4S2/c1-4-19(20(23)21-14-15-27-18-8-6-5-7-9-18)22(28(3,24)25)16-10-12-17(26-2)13-11-16/h10-13,18-19H,4-9,14-15H2,1-3H3,(H,21,23) |
| InChIKey | CVEZGIPYEDVWSR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|