C19H30N2O4S2 — CID 133161452
N-(2-cyclopentylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide (PubChem CID 133161452) has the molecular formula C19H30N2O4S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide |
|---|---|
| PubChem CID | 133161452 |
| Molecular Formula | C19H30N2O4S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide |
| SMILES | CCC(Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)NCCSC1CCCC1 |
| InChI | InChI=1S/C19H30N2O4S2/c1-4-18(19(22)20-13-14-26-17-7-5-6-8-17)25-16-11-9-15(10-12-16)21(2)27(3,23)24/h9-12,17-18H,4-8,13-14H2,1-3H3,(H,20,22) |
| InChIKey | ZPZCCWCFFRQOGF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|