C18H26FNO2S — CID 92684204
(2S)-N-(2-cyclohexylsulfanylethyl)-2-(4-fluorophenoxy)butanamide (PubChem CID 92684204) has the molecular formula C18H26FNO2S and a molecular weight of 339.48 g/mol. Its IUPAC name is (2S)-N-(2-cyclohexylsulfanylethyl)-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2S)-N-(2-cyclohexylsulfanylethyl)-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 92684204 |
| Molecular Formula | C18H26FNO2S |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2S)-N-(2-cyclohexylsulfanylethyl)-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)NCCSC1CCCCC1 |
| InChI | InChI=1S/C18H26FNO2S/c1-2-17(22-15-10-8-14(19)9-11-15)18(21)20-12-13-23-16-6-4-3-5-7-16/h8-11,16-17H,2-7,12-13H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | QNMAREWOKQSCFI-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|