C16H24FNO2S — CID 38012795
(2S)-N-(2-tert-butylsulfanylethyl)-2-(4-fluorophenoxy)butanamide (PubChem CID 38012795) has the molecular formula C16H24FNO2S and a molecular weight of 313.44 g/mol. Its IUPAC name is (2S)-N-(2-tert-butylsulfanylethyl)-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 38012795 |
| Molecular Formula | C16H24FNO2S |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)NCCSC(C)(C)C |
| InChI | InChI=1S/C16H24FNO2S/c1-5-14(20-13-8-6-12(17)7-9-13)15(19)18-10-11-21-16(2,3)4/h6-9,14H,5,10-11H2,1-4H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | KNTDHYYVDJZLBQ-AWEZNQCLSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|