C21H26FNO2 — CID 46771830
2-(4-fluorophenoxy)-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide (PubChem CID 46771830) has the molecular formula C21H26FNO2 and a molecular weight of 343.44 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 46771830 |
| Molecular Formula | C21H26FNO2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)NCCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H26FNO2/c1-4-20(25-19-11-9-18(22)10-12-19)21(24)23-14-13-16-5-7-17(8-6-16)15(2)3/h5-12,15,20H,4,13-14H2,1-3H3,(H,23,24) |
| InChIKey | XGWKAMAXTXNXEL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |