C18H19F2NO2 — CID 133211109
2-(2-fluorophenoxy)-N-[2-(4-fluorophenyl)ethyl]butanamide (PubChem CID 133211109) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[2-(4-fluorophenyl)ethyl]butanamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[2-(4-fluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 133211109 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[2-(4-fluorophenyl)ethyl]butanamide |
| SMILES | CCC(Oc1ccccc1F)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19F2NO2/c1-2-16(23-17-6-4-3-5-15(17)20)18(22)21-12-11-13-7-9-14(19)10-8-13/h3-10,16H,2,11-12H2,1H3,(H,21,22) |
| InChIKey | PKGCXQJCQVWPLX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |