C14H20FNO3 — CID 40747099
(2S)-2-(2-fluorophenoxy)-N-(3-methoxypropyl)butanamide (PubChem CID 40747099) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenoxy)-N-(3-methoxypropyl)butanamide.
| Compound Name | (2S)-2-(2-fluorophenoxy)-N-(3-methoxypropyl)butanamide |
|---|---|
| PubChem CID | 40747099 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2S)-2-(2-fluorophenoxy)-N-(3-methoxypropyl)butanamide |
| SMILES | CC[C@H](Oc1ccccc1F)C(=O)NCCCOC |
| InChI | InChI=1S/C14H20FNO3/c1-3-12(14(17)16-9-6-10-18-2)19-13-8-5-4-7-11(13)15/h4-5,7-8,12H,3,6,9-10H2,1-2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | KNTDOOHHRLUNOY-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|