C17H20FNO3 — CID 53286413
2-(2-fluorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide (PubChem CID 53286413) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 53286413 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide |
| SMILES | CCC(Oc1ccccc1F)C(=O)NCCCc1ccco1 |
| InChI | InChI=1S/C17H20FNO3/c1-2-15(22-16-10-4-3-9-14(16)18)17(20)19-11-5-7-13-8-6-12-21-13/h3-4,6,8-10,12,15H,2,5,7,11H2,1H3,(H,19,20) |
| InChIKey | QFCDCAWEDOLPOF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|