C17H20ClNO3 — CID 53285212
2-(4-chlorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide (PubChem CID 53285212) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 53285212 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[3-(furan-2-yl)propyl]butanamide |
| SMILES | CCC(Oc1ccc(Cl)cc1)C(=O)NCCCc1ccco1 |
| InChI | InChI=1S/C17H20ClNO3/c1-2-16(22-15-9-7-13(18)8-10-15)17(20)19-11-3-5-14-6-4-12-21-14/h4,6-10,12,16H,2-3,5,11H2,1H3,(H,19,20) |
| InChIKey | KSNAGQZGTMTWCG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|