C23H24FNO2 — CID 94012280
(2S)-N-[3-(4-fluorophenyl)propyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 94012280) has the molecular formula C23H24FNO2 and a molecular weight of 365.45 g/mol. Its IUPAC name is (2S)-N-[3-(4-fluorophenyl)propyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2S)-N-[3-(4-fluorophenyl)propyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 94012280 |
| Molecular Formula | C23H24FNO2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (2S)-N-[3-(4-fluorophenyl)propyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)NCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FNO2/c1-2-22(27-21-14-11-18-7-3-4-8-19(18)16-21)23(26)25-15-5-6-17-9-12-20(24)13-10-17/h3-4,7-14,16,22H,2,5-6,15H2,1H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | FVFAMIGAVYTROY-QFIPXVFZSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|