C22H22FNO3 — CID 133240085
N-[2-(4-fluorophenoxy)ethyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 133240085) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 133240085 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CCC(Oc1ccc2ccccc2c1)C(=O)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FNO3/c1-2-21(27-20-10-7-16-5-3-4-6-17(16)15-20)22(25)24-13-14-26-19-11-8-18(23)9-12-19/h3-12,15,21H,2,13-14H2,1H3,(H,24,25) |
| InChIKey | SZXLPHZYZXJARP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|