C22H27FN2O3 — CID 108538670
N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-(4-propan-2-ylphenoxy)propanamide (PubChem CID 108538670) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-(4-propan-2-ylphenoxy)propanamide.
| Compound Name | N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-(4-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 108538670 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-(4-propan-2-ylphenoxy)propanamide |
| SMILES | CC(Oc1ccc(C(C)C)cc1)C(=O)NCCNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN2O3/c1-15(2)18-6-10-20(11-7-18)28-16(3)22(27)25-13-12-24-21(26)14-17-4-8-19(23)9-5-17/h4-11,15-16H,12-14H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | RLIFEAGTJIIKSD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|