C21H23F3N2O3 — CID 108541583
2,3,4-trifluoro-N-[2-[2-(4-propan-2-ylphenoxy)propanoylamino]ethyl]benzamide (PubChem CID 108541583) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-[2-(4-propan-2-ylphenoxy)propanoylamino]ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-[2-(4-propan-2-ylphenoxy)propanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 108541583 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-[2-(4-propan-2-ylphenoxy)propanoylamino]ethyl]benzamide |
| SMILES | CC(Oc1ccc(C(C)C)cc1)C(=O)NCCNC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H23F3N2O3/c1-12(2)14-4-6-15(7-5-14)29-13(3)20(27)25-10-11-26-21(28)16-8-9-17(22)19(24)18(16)23/h4-9,12-13H,10-11H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | NNUKEBGHWYOYMF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|