C21H24Cl2N2O4 — CID 4944309
2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)propanoylamino]propyl]propanamide (PubChem CID 4944309) has the molecular formula C21H24Cl2N2O4 and a molecular weight of 439.34 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)propanoylamino]propyl]propanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)propanoylamino]propyl]propanamide |
|---|---|
| PubChem CID | 4944309 |
| Molecular Formula | C21H24Cl2N2O4 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)propanoylamino]propyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)NCCCNC(=O)C(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O4/c1-14(28-18-8-4-16(22)5-9-18)20(26)24-12-3-13-25-21(27)15(2)29-19-10-6-17(23)7-11-19/h4-11,14-15H,3,12-13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | RLHIIFNMTQFVPE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|