C13H18Cl2N2O2 — CID 119433605
2-(3,5-dichlorophenoxy)-N-[3-(methylamino)propyl]propanamide (PubChem CID 119433605) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-[3-(methylamino)propyl]propanamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-[3-(methylamino)propyl]propanamide |
|---|---|
| PubChem CID | 119433605 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-[3-(methylamino)propyl]propanamide |
| SMILES | CNCCCNC(=O)C(C)Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-9(13(18)17-5-3-4-16-2)19-12-7-10(14)6-11(15)8-12/h6-9,16H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | BSGUQIPHVJCFBU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|