C11H14Cl2N2O2 — CID 119385080
N-(2-aminoethyl)-2-(3,5-dichlorophenoxy)propanamide (PubChem CID 119385080) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(3,5-dichlorophenoxy)propanamide.
| Compound Name | N-(2-aminoethyl)-2-(3,5-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 119385080 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-(2-aminoethyl)-2-(3,5-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1cc(Cl)cc(Cl)c1)C(=O)NCCN |
| InChI | InChI=1S/C11H14Cl2N2O2/c1-7(11(16)15-3-2-14)17-10-5-8(12)4-9(13)6-10/h4-7H,2-3,14H2,1H3,(H,15,16) |
| InChIKey | QFFPQJCJRKMIGM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |