C13H19ClN2O2 — CID 41368435
(2R)-2-(4-chlorophenoxy)-N-[2-(dimethylamino)ethyl]propanamide (PubChem CID 41368435) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-N-[2-(dimethylamino)ethyl]propanamide.
| Compound Name | (2R)-2-(4-chlorophenoxy)-N-[2-(dimethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 41368435 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-N-[2-(dimethylamino)ethyl]propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1)C(=O)NCCN(C)C |
| InChI | InChI=1S/C13H19ClN2O2/c1-10(13(17)15-8-9-16(2)3)18-12-6-4-11(14)5-7-12/h4-7,10H,8-9H2,1-3H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | OHVNMUXPEOJAAV-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |