C13H20ClN3O4S — CID 108572712
2-(4-chlorophenoxy)-N-[2-(dimethylsulfamoylamino)ethyl]propanamide (PubChem CID 108572712) has the molecular formula C13H20ClN3O4S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-(dimethylsulfamoylamino)ethyl]propanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-(dimethylsulfamoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 108572712 |
| Molecular Formula | C13H20ClN3O4S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-(dimethylsulfamoylamino)ethyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)NCCNS(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H20ClN3O4S/c1-10(21-12-6-4-11(14)5-7-12)13(18)15-8-9-16-22(19,20)17(2)3/h4-7,10,16H,8-9H2,1-3H3,(H,15,18) |
| InChIKey | IPVBLZZDJRXZLR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|