C15H23FN2O2 — CID 99952368
(2R)-N-[3-(dimethylamino)propyl]-2-(4-fluorophenoxy)butanamide (PubChem CID 99952368) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is (2R)-N-[3-(dimethylamino)propyl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2R)-N-[3-(dimethylamino)propyl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 99952368 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2R)-N-[3-(dimethylamino)propyl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc(F)cc1)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C15H23FN2O2/c1-4-14(15(19)17-10-5-11-18(2)3)20-13-8-6-12(16)7-9-13/h6-9,14H,4-5,10-11H2,1-3H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | QVSSKMKNSYPTBA-CQSZACIVSA-N |
| XLogP | 2.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|