C19H20Cl2FNO2S — CID 46772169
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluorophenoxy)butanamide (PubChem CID 46772169) has the molecular formula C19H20Cl2FNO2S and a molecular weight of 416.35 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 46772169 |
| Molecular Formula | C19H20Cl2FNO2S |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)NCCSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H20Cl2FNO2S/c1-2-18(25-14-8-6-13(22)7-9-14)19(24)23-10-11-26-12-15-16(20)4-3-5-17(15)21/h3-9,18H,2,10-12H2,1H3,(H,23,24) |
| InChIKey | JYPQYJWTLJNAKQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|