C19H21Cl2NO2S — CID 9180836
(2S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-phenoxybutanamide (PubChem CID 9180836) has the molecular formula C19H21Cl2NO2S and a molecular weight of 398.36 g/mol. Its IUPAC name is (2S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-phenoxybutanamide.
| Compound Name | (2S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-phenoxybutanamide |
|---|---|
| PubChem CID | 9180836 |
| Molecular Formula | C19H21Cl2NO2S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (2S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-phenoxybutanamide |
| SMILES | CC[C@H](Oc1ccccc1)C(=O)NCCSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H21Cl2NO2S/c1-2-18(24-14-7-4-3-5-8-14)19(23)22-11-12-25-13-15-16(20)9-6-10-17(15)21/h3-10,18H,2,11-13H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | KCPRUWXSNIQDOA-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|