C19H20Cl3NO2S — CID 92675597
(2R)-2-(3-chlorophenoxy)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]butanamide (PubChem CID 92675597) has the molecular formula C19H20Cl3NO2S and a molecular weight of 432.80 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]butanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 92675597 |
| Molecular Formula | C19H20Cl3NO2S |
| Molecular Weight | 432.80 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc(Cl)c1)C(=O)NCCSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H20Cl3NO2S/c1-2-18(25-14-6-3-5-13(20)11-14)19(24)23-9-10-26-12-15-16(21)7-4-8-17(15)22/h3-8,11,18H,2,9-10,12H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | WYNAYOGITSJCOW-GOSISDBHSA-N |
| XLogP | 5.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.80 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|