C23H24ClNO2S — CID 46764606
N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 46764606) has the molecular formula C23H24ClNO2S and a molecular weight of 413.97 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 46764606 |
| Molecular Formula | C23H24ClNO2S |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CCC(Oc1ccc2ccccc2c1)C(=O)NCCSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24ClNO2S/c1-2-22(27-21-11-10-18-7-3-4-8-19(18)15-21)23(26)25-12-13-28-16-17-6-5-9-20(24)14-17/h3-11,14-15,22H,2,12-13,16H2,1H3,(H,25,26) |
| InChIKey | KAYPXDJHVAAROM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|