C21H20ClNO2 — CID 99131305
(2S)-N-[(4-chlorophenyl)methyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 99131305) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is (2S)-N-[(4-chlorophenyl)methyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2S)-N-[(4-chlorophenyl)methyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 99131305 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2S)-N-[(4-chlorophenyl)methyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO2/c1-2-20(21(24)23-14-15-7-10-18(22)11-8-15)25-19-12-9-16-5-3-4-6-17(16)13-19/h3-13,20H,2,14H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | LPERLDSSSQEPPM-FQEVSTJZSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |