C22H23NO2 — CID 28575311
(2R)-N-[(4-methylphenyl)methyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 28575311) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R)-N-[(4-methylphenyl)methyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2R)-N-[(4-methylphenyl)methyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 28575311 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2R)-N-[(4-methylphenyl)methyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@@H](Oc1ccc2ccccc2c1)C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H23NO2/c1-3-21(22(24)23-15-17-10-8-16(2)9-11-17)25-20-13-12-18-6-4-5-7-19(18)14-20/h4-14,21H,3,15H2,1-2H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | AEHZFTMZXFMLTO-OAQYLSRUSA-N |
| XLogP | 4.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |