C21H26ClNO2S — CID 92646274
(2S)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethylphenoxy)butanamide (PubChem CID 92646274) has the molecular formula C21H26ClNO2S and a molecular weight of 391.96 g/mol. Its IUPAC name is (2S)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethylphenoxy)butanamide.
| Compound Name | (2S)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 92646274 |
| Molecular Formula | C21H26ClNO2S |
| Molecular Weight | 391.96 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2S)-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethylphenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(C)c(C)c1)C(=O)NCCSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H26ClNO2S/c1-4-20(25-19-9-8-15(2)16(3)12-19)21(24)23-10-11-26-14-17-6-5-7-18(22)13-17/h5-9,12-13,20H,4,10-11,14H2,1-3H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | VMVYVINAQVRSLC-FQEVSTJZSA-N |
| XLogP | 5.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|