C20H22Cl3NO2S — CID 132673957
2-(4-chloro-3-methylphenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]butanamide (PubChem CID 132673957) has the molecular formula C20H22Cl3NO2S and a molecular weight of 446.83 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]butanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 132673957 |
| Molecular Formula | C20H22Cl3NO2S |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]butanamide |
| SMILES | CCC(Oc1ccc(Cl)c(C)c1)C(=O)NCCSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl3NO2S/c1-3-19(26-16-6-7-17(22)13(2)10-16)20(25)24-8-9-27-12-14-4-5-15(21)11-18(14)23/h4-7,10-11,19H,3,8-9,12H2,1-2H3,(H,24,25) |
| InChIKey | KRPXZNNGOWDIFP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|