C18H19Cl2NO2 — CID 132653123
2-(4-chloro-3-methylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide (PubChem CID 132653123) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 132653123 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide |
| SMILES | CCC(Oc1ccc(Cl)c(C)c1)C(=O)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C18H19Cl2NO2/c1-4-17(23-14-7-8-15(20)12(3)9-14)18(22)21-16-10-13(19)6-5-11(16)2/h5-10,17H,4H2,1-3H3,(H,21,22) |
| InChIKey | WYSCXGFVZRDERY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |