C17H16ClF2NO2 — CID 53288921
2-(4-chloro-3-methylphenoxy)-N-(2,4-difluorophenyl)butanamide (PubChem CID 53288921) has the molecular formula C17H16ClF2NO2 and a molecular weight of 339.77 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-(2,4-difluorophenyl)butanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-(2,4-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 53288921 |
| Molecular Formula | C17H16ClF2NO2 |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-(2,4-difluorophenyl)butanamide |
| SMILES | CCC(Oc1ccc(Cl)c(C)c1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H16ClF2NO2/c1-3-16(23-12-5-6-13(18)10(2)8-12)17(22)21-15-7-4-11(19)9-14(15)20/h4-9,16H,3H2,1-2H3,(H,21,22) |
| InChIKey | STKAERRWNNHGBJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |