C18H20ClNO2 — CID 43905074
2-(3-chlorophenoxy)-N-(2,5-dimethylphenyl)butanamide (PubChem CID 43905074) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(2,5-dimethylphenyl)butanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(2,5-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 43905074 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(2,5-dimethylphenyl)butanamide |
| SMILES | CCC(Oc1cccc(Cl)c1)C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C18H20ClNO2/c1-4-17(22-15-7-5-6-14(19)11-15)18(21)20-16-10-12(2)8-9-13(16)3/h5-11,17H,4H2,1-3H3,(H,20,21) |
| InChIKey | UQFWQLILKFODKV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |