C17H17Cl2NO2 — CID 43916773
N-(3-chloro-2-methylphenyl)-2-(3-chlorophenoxy)butanamide (PubChem CID 43916773) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-(3-chlorophenoxy)butanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-(3-chlorophenoxy)butanamide |
|---|---|
| PubChem CID | 43916773 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-(3-chlorophenoxy)butanamide |
| SMILES | CCC(Oc1cccc(Cl)c1)C(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C17H17Cl2NO2/c1-3-16(22-13-7-4-6-12(18)10-13)17(21)20-15-9-5-8-14(19)11(15)2/h4-10,16H,3H2,1-2H3,(H,20,21) |
| InChIKey | XJVBZTWRAVBJHN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |