C18H18ClNO4 — CID 43904326
methyl 2-[2-(3-chlorophenoxy)butanoylamino]benzoate (PubChem CID 43904326) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is methyl 2-[2-(3-chlorophenoxy)butanoylamino]benzoate.
| Compound Name | methyl 2-[2-(3-chlorophenoxy)butanoylamino]benzoate |
|---|---|
| PubChem CID | 43904326 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | methyl 2-[2-(3-chlorophenoxy)butanoylamino]benzoate |
| SMILES | CCC(Oc1cccc(Cl)c1)C(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C18H18ClNO4/c1-3-16(24-13-8-6-7-12(19)11-13)17(21)20-15-10-5-4-9-14(15)18(22)23-2/h4-11,16H,3H2,1-2H3,(H,20,21) |
| InChIKey | WCTYJHCUPNVHCU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |