C20H23NO5 — CID 30391174
ethyl 2-[[(2S)-2-(3-methoxyphenoxy)butanoyl]amino]benzoate (PubChem CID 30391174) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-(3-methoxyphenoxy)butanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[(2S)-2-(3-methoxyphenoxy)butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 30391174 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | ethyl 2-[[(2S)-2-(3-methoxyphenoxy)butanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)[C@H](CC)Oc1cccc(OC)c1 |
| InChI | InChI=1S/C20H23NO5/c1-4-18(26-15-10-8-9-14(13-15)24-3)19(22)21-17-12-7-6-11-16(17)20(23)25-5-2/h6-13,18H,4-5H2,1-3H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | XRMGVBPZYLAUEA-SFHVURJKSA-N |
| XLogP | 3.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |