C20H23Cl2NO2S — CID 28635218
(2R)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methylphenoxy)butanamide (PubChem CID 28635218) has the molecular formula C20H23Cl2NO2S and a molecular weight of 412.38 g/mol. Its IUPAC name is (2R)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methylphenoxy)butanamide.
| Compound Name | (2R)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 28635218 |
| Molecular Formula | C20H23Cl2NO2S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (2R)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1cccc(C)c1)C(=O)NCCSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2NO2S/c1-3-19(25-17-6-4-5-14(2)11-17)20(24)23-9-10-26-13-15-7-8-16(21)12-18(15)22/h4-8,11-12,19H,3,9-10,13H2,1-2H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | IKXJHSHZYGRZKA-LJQANCHMSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|