C18H30N2O4S2 — CID 100651688
(2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide (PubChem CID 100651688) has the molecular formula C18H30N2O4S2 and a molecular weight of 402.58 g/mol. Its IUPAC name is (2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide.
| Compound Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide |
|---|---|
| PubChem CID | 100651688 |
| Molecular Formula | C18H30N2O4S2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanamide |
| SMILES | CC[C@@H](Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)NCCSC(C)(C)C |
| InChI | InChI=1S/C18H30N2O4S2/c1-7-16(17(21)19-12-13-25-18(2,3)4)24-15-10-8-14(9-11-15)20(5)26(6,22)23/h8-11,16H,7,12-13H2,1-6H3,(H,19,21)/t16-/m1/s1 |
| InChIKey | KBHUXOFDTCNDME-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|