C17H28N2O4S2 — CID 100623528
(2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide (PubChem CID 100623528) has the molecular formula C17H28N2O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is (2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide.
| Compound Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide |
|---|---|
| PubChem CID | 100623528 |
| Molecular Formula | C17H28N2O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide |
| SMILES | C[C@@H](Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)NCCSC(C)(C)C |
| InChI | InChI=1S/C17H28N2O4S2/c1-13(16(20)18-11-12-24-17(2,3)4)23-15-9-7-14(8-10-15)19(5)25(6,21)22/h7-10,13H,11-12H2,1-6H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | CFXXAVUJBPGOSU-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|