C20H24Cl2N2O4S2 — CID 133184165
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide (PubChem CID 133184165) has the molecular formula C20H24Cl2N2O4S2 and a molecular weight of 491.46 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide |
|---|---|
| PubChem CID | 133184165 |
| Molecular Formula | C20H24Cl2N2O4S2 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide |
| SMILES | CC(Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)NCCSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24Cl2N2O4S2/c1-14(28-17-7-5-16(6-8-17)24(2)30(3,26)27)20(25)23-10-11-29-13-15-4-9-18(21)19(22)12-15/h4-9,12,14H,10-11,13H2,1-3H3,(H,23,25) |
| InChIKey | OGDDGVNXYJHBKP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|