C19H21Cl2NO3S — CID 92684620
(2R)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methoxyphenoxy)propanamide (PubChem CID 92684620) has the molecular formula C19H21Cl2NO3S and a molecular weight of 414.35 g/mol. Its IUPAC name is (2R)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methoxyphenoxy)propanamide.
| Compound Name | (2R)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 92684620 |
| Molecular Formula | C19H21Cl2NO3S |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (2R)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3-methoxyphenoxy)propanamide |
| SMILES | COc1cccc(O[C@H](C)C(=O)NCCSCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H21Cl2NO3S/c1-13(25-16-5-3-4-15(11-16)24-2)19(23)22-8-9-26-12-14-6-7-17(20)18(21)10-14/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | CGXVNDGNTPJFMJ-CYBMUJFWSA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|