C17H18Cl2N2O2S — CID 100747065
1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2-methoxyphenyl)urea (PubChem CID 100747065) has the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.32 g/mol. Its IUPAC name is 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 100747065 |
| Molecular Formula | C17H18Cl2N2O2S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCCSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O2S/c1-23-16-5-3-2-4-15(16)21-17(22)20-8-9-24-11-12-6-7-13(18)14(19)10-12/h2-7,10H,8-9,11H2,1H3,(H2,20,21,22) |
| InChIKey | ZPBSJCSAFIJZEF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|