C16H16Cl2N2OS — CID 100569621
1-(2-benzylsulfanylethyl)-3-(3,4-dichlorophenyl)urea (PubChem CID 100569621) has the molecular formula C16H16Cl2N2OS and a molecular weight of 355.29 g/mol. Its IUPAC name is 1-(2-benzylsulfanylethyl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(2-benzylsulfanylethyl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 100569621 |
| Molecular Formula | C16H16Cl2N2OS |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-(2-benzylsulfanylethyl)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NCCSCc1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2OS/c17-14-7-6-13(10-15(14)18)20-16(21)19-8-9-22-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H2,19,20,21) |
| InChIKey | OSAMERJYXBSYDR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|